ChemNet > CAS > 175278-42-9 2-[(4-methylphenyl)thio]-5-nitrobenzaldehyde
175278-42-9 2-[(4-methylphenyl)thio]-5-nitrobenzaldehyde
| product Name |
2-[(4-methylphenyl)thio]-5-nitrobenzaldehyde |
| CAS No |
175278-42-9 |
| Synonyms |
2-[(4-methylphenyl)sulfanyl]-5-nitrobenzaldehyde |
| Molecular Formula |
C14H11NO3S |
| Molecular Weight |
273.307 |
| InChI |
InChI=1/C14H11NO3S/c1-10-2-5-13(6-3-10)19-14-7-4-12(15(17)18)8-11(14)9-16/h2-9H,1H3 |
| Molecular Structure |
|
| Density |
1.33g/cm3 |
| Melting point |
155℃ |
| Boiling point |
429.2°C at 760 mmHg |
| Refractive index |
1.652 |
| Flash point |
213.4°C |
| Vapour Pressur |
1.43E-07mmHg at 25°C |
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|